PHOSPHORUS DIMETHYL PHENYL
Dimethylphenylphosphine
CAS: 672-66-2
Molecular Formula: C8H11P
PHOSPHORUS DIMETHYL PHENYL - Names and Identifiers
| Name | Dimethylphenylphosphine |
| Synonyms | DIMETHYLPHENYLPHOSPHINE Dimethylphenylphosphine Phenyldimethylphosphine dimethyl(phenyl)phosphane PHOSPHORUS DIMETHYL PHENYL Phosphine, dimethylphenyl- |
| CAS | 672-66-2 |
| EINECS | 211-595-3 |
| InChI | InChI=1/C8H11P/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
PHOSPHORUS DIMETHYL PHENYL - Physico-chemical Properties
| Molecular Formula | C8H11P |
| Molar Mass | 138.15 |
| Density | 0.971g/mLat 25°C(lit.) |
| Melting Point | 126-127℃ |
| Boling Point | 74-75°C12mm Hg(lit.) |
| Flash Point | 122°F |
| Solubility | Soluble in organic solvents. |
| Vapor Presure | 11 mm Hg ( 68 °C) |
| Appearance | Liquid |
| Specific Gravity | 0.967 |
| Color | Clear colorless |
| BRN | 742064 |
| Storage Condition | Flammables area |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.563(lit.) |
PHOSPHORUS DIMETHYL PHENYL - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S16 - Keep away from sources of ignition. |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 1-13 |
| TSCA | No |
| HS Code | 29319090 |
| Hazard Class | 6.1 |
| Packing Group | II |
PHOSPHORUS DIMETHYL PHENYL - Introduction
Dimethylphenylphosphine(Dimethylphenylphosphine) is an organophosphorus compound with the chemical formula C8H11P. Its nature is as follows:
1. Appearance: colorless liquid or crystalline solid.
2. solubility: soluble in common organic solvents, such as ethanol and ether.
3. melting point: about -26 ℃.
4. Boiling point: about 110 ℃.
5. non-flammable, but can support combustion.
The main uses of Dimethylphenylphosphine are as follows:
1. Catalyst: As a ligand of the catalyst, it can participate in metal-catalyzed reactions, such as hydrogenation, olefin halogenation, etc.
2. Organic synthesis intermediates: can be used as intermediates for the synthesis of other organic compounds (such as drugs, pesticides, etc.).
3. metal organic chemistry: as a donor ligand to participate in the synthesis and reaction of metal organic compounds.
There are two common methods for the preparation of Dimethylphenylphosphine:
1. Grignard reaction: by the reaction of methyl magnesium bromide and phenyl phosphonic acid.
2. Hydrogenation reaction: Dimethylphenylphosphine was obtained by hydrogenation of phenylphosphonic acid.
Regarding safety information, Dimethylphenylphosphine have certain toxicity and irritation, so corresponding safety measures need to be taken during use. Keep away from fire and high temperature, and operate in a well-ventilated place. Wear chemical protective goggles and gloves to avoid skin contact. If ingested or inhaled, seek medical attention immediately.
1. Appearance: colorless liquid or crystalline solid.
2. solubility: soluble in common organic solvents, such as ethanol and ether.
3. melting point: about -26 ℃.
4. Boiling point: about 110 ℃.
5. non-flammable, but can support combustion.
The main uses of Dimethylphenylphosphine are as follows:
1. Catalyst: As a ligand of the catalyst, it can participate in metal-catalyzed reactions, such as hydrogenation, olefin halogenation, etc.
2. Organic synthesis intermediates: can be used as intermediates for the synthesis of other organic compounds (such as drugs, pesticides, etc.).
3. metal organic chemistry: as a donor ligand to participate in the synthesis and reaction of metal organic compounds.
There are two common methods for the preparation of Dimethylphenylphosphine:
1. Grignard reaction: by the reaction of methyl magnesium bromide and phenyl phosphonic acid.
2. Hydrogenation reaction: Dimethylphenylphosphine was obtained by hydrogenation of phenylphosphonic acid.
Regarding safety information, Dimethylphenylphosphine have certain toxicity and irritation, so corresponding safety measures need to be taken during use. Keep away from fire and high temperature, and operate in a well-ventilated place. Wear chemical protective goggles and gloves to avoid skin contact. If ingested or inhaled, seek medical attention immediately.
Last Update：2024-04-09 20:49:11
Supplier List
Featured ProductsSpot supply
Product Name: Dimethylphenylphosphine Request for quotationCAS: 672-66-2
Tel: 15001012717
Email: biz5@infsci.com
Mobile: 15001012717
QQ: 3007471201
Product List: View Catalog
Featured ProductsSpot supply
Product Name: Dimethylphenylphosphine Request for quotationCAS: 672-66-2
Tel: 15001012717
Email: biz5@infsci.com
Mobile: 15001012717
QQ: 3007471201
Product List: View Catalog
View History